C17H15F3N2O2 — CID 110362363
2,3,4-trifluoro-N-(3-morpholin-4-ylphenyl)benzamide (PubChem CID 110362363) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(3-morpholin-4-ylphenyl)benzamide.
| Compound Name | 2,3,4-trifluoro-N-(3-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 110362363 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2,3,4-trifluoro-N-(3-morpholin-4-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCOCC2)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H15F3N2O2/c18-14-5-4-13(15(19)16(14)20)17(23)21-11-2-1-3-12(10-11)22-6-8-24-9-7-22/h1-5,10H,6-9H2,(H,21,23) |
| InChIKey | HCOASABDABJFEH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|