C19H17F3N2O3 — CID 110352884
2,3,4-trifluoro-N-[3-(3-methylmorpholine-4-carbonyl)phenyl]benzamide (PubChem CID 110352884) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[3-(3-methylmorpholine-4-carbonyl)phenyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[3-(3-methylmorpholine-4-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 110352884 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2,3,4-trifluoro-N-[3-(3-methylmorpholine-4-carbonyl)phenyl]benzamide |
| SMILES | CC1COCCN1C(=O)c1cccc(NC(=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H17F3N2O3/c1-11-10-27-8-7-24(11)19(26)12-3-2-4-13(9-12)23-18(25)14-5-6-15(20)17(22)16(14)21/h2-6,9,11H,7-8,10H2,1H3,(H,23,25) |
| InChIKey | ITJMVLIRVWJUTE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|