C21H24N2O3 — CID 110671847
N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-2-(3-methylphenyl)acetamide (PubChem CID 110671847) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 110671847 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)Nc2cccc(C(=O)N3CCOCC3C)c2)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-15-5-3-6-17(11-15)12-20(24)22-19-8-4-7-18(13-19)21(25)23-9-10-26-14-16(23)2/h3-8,11,13,16H,9-10,12,14H2,1-2H3,(H,22,24) |
| InChIKey | JWRKAECOUPSURZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |