C20H24N2O4S — CID 110352918
N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-1-(4-methylphenyl)methanesulfonamide (PubChem CID 110352918) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-1-(4-methylphenyl)methanesulfonamide.
| Compound Name | N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-1-(4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110352918 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[3-(3-methylmorpholine-4-carbonyl)phenyl]-1-(4-methylphenyl)methanesulfonamide |
| SMILES | Cc1ccc(CS(=O)(=O)Nc2cccc(C(=O)N3CCOCC3C)c2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15-6-8-17(9-7-15)14-27(24,25)21-19-5-3-4-18(12-19)20(23)22-10-11-26-13-16(22)2/h3-9,12,16,21H,10-11,13-14H2,1-2H3 |
| InChIKey | SUDVJRVDXKBZQT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |