C20H19F3N2O3 — CID 110352811
N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,3,4-trifluorobenzamide (PubChem CID 110352811) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 110352811 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,3,4-trifluorobenzamide |
| SMILES | CC1(C)COCCN1C(=O)c1ccc(NC(=O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c1-20(2)11-28-10-9-25(20)19(27)12-3-5-13(6-4-12)24-18(26)14-7-8-15(21)17(23)16(14)22/h3-8H,9-11H2,1-2H3,(H,24,26) |
| InChIKey | LKBRGGAQTTZSEM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|