C15H23N3O4S — CID 110352824
4-[4-(dimethylsulfamoylamino)benzoyl]-3,3-dimethylmorpholine (PubChem CID 110352824) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-[4-(dimethylsulfamoylamino)benzoyl]-3,3-dimethylmorpholine.
| Compound Name | 4-[4-(dimethylsulfamoylamino)benzoyl]-3,3-dimethylmorpholine |
|---|---|
| PubChem CID | 110352824 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[4-(dimethylsulfamoylamino)benzoyl]-3,3-dimethylmorpholine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(C(=O)N2CCOCC2(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O4S/c1-15(2)11-22-10-9-18(15)14(19)12-5-7-13(8-6-12)16-23(20,21)17(3)4/h5-8,16H,9-11H2,1-4H3 |
| InChIKey | AILAQXHNHKSMRO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |