C22H26N2O5 — CID 110352783
N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,6-dimethoxybenzamide (PubChem CID 110352783) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 110352783 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[4-(3,3-dimethylmorpholine-4-carbonyl)phenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(C(=O)N2CCOCC2(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-22(2)14-29-13-12-24(22)21(26)15-8-10-16(11-9-15)23-20(25)19-17(27-3)6-5-7-18(19)28-4/h5-11H,12-14H2,1-4H3,(H,23,25) |
| InChIKey | AMVQSOOVJUIKNB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |