C17H17BrN2O2 — CID 110362330
3-bromo-N-(3-morpholin-4-ylphenyl)benzamide (PubChem CID 110362330) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is 3-bromo-N-(3-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3-bromo-N-(3-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 110362330 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 3-bromo-N-(3-morpholin-4-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCOCC2)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H17BrN2O2/c18-14-4-1-3-13(11-14)17(21)19-15-5-2-6-16(12-15)20-7-9-22-10-8-20/h1-6,11-12H,7-10H2,(H,19,21) |
| InChIKey | TXQSUNNFTGOAOS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|