C18H18BrN3O2S — CID 1276210
3-bromo-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide (PubChem CID 1276210) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is 3-bromo-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1276210 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 3-bromo-N-[(4-morpholin-4-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCOCC2)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H18BrN3O2S/c19-14-3-1-2-13(12-14)17(23)21-18(25)20-15-4-6-16(7-5-15)22-8-10-24-11-9-22/h1-7,12H,8-11H2,(H2,20,21,23,25) |
| InChIKey | XGHDPRLVVJZZFD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|