C18H20N4O3 — CID 86821869
3-(carbamoylamino)-N-(3-morpholin-4-ylphenyl)benzamide (PubChem CID 86821869) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-(3-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3-(carbamoylamino)-N-(3-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 86821869 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-(carbamoylamino)-N-(3-morpholin-4-ylphenyl)benzamide |
| SMILES | NC(=O)Nc1cccc(C(=O)Nc2cccc(N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C18H20N4O3/c19-18(24)21-14-4-1-3-13(11-14)17(23)20-15-5-2-6-16(12-15)22-7-9-25-10-8-22/h1-6,11-12H,7-10H2,(H,20,23)(H3,19,21,24) |
| InChIKey | HQVYVLDHCARYLO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|