C23H29BN2O4 — CID 67061305
N-(3-morpholin-4-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 67061305) has the molecular formula C23H29BN2O4 and a molecular weight of 408.31 g/mol. Its IUPAC name is N-(3-morpholin-4-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | N-(3-morpholin-4-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 67061305 |
| Molecular Formula | C23H29BN2O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-(3-morpholin-4-ylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2cccc(C(=O)Nc3cccc(N4CCOCC4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C23H29BN2O4/c1-22(2)23(3,4)30-24(29-22)18-8-5-7-17(15-18)21(27)25-19-9-6-10-20(16-19)26-11-13-28-14-12-26/h5-10,15-16H,11-14H2,1-4H3,(H,25,27) |
| InChIKey | PWOGQCIOIPHKQN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|