C17H15BrN2O5S — CID 26921628
5-bromo-N-(4-methoxy-3-sulfamoylphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 26921628) has the molecular formula C17H15BrN2O5S and a molecular weight of 439.29 g/mol. Its IUPAC name is 5-bromo-N-(4-methoxy-3-sulfamoylphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-(4-methoxy-3-sulfamoylphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 26921628 |
| Molecular Formula | C17H15BrN2O5S |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 5-bromo-N-(4-methoxy-3-sulfamoylphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2oc3ccc(Br)cc3c2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C17H15BrN2O5S/c1-9-12-7-10(18)3-5-13(12)25-16(9)17(21)20-11-4-6-14(24-2)15(8-11)26(19,22)23/h3-8H,1-2H3,(H,20,21)(H2,19,22,23) |
| InChIKey | SKABXDYEVYCTAV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |