C18H13BrClNO4 — CID 18273257
methyl 3-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-chlorobenzoate (PubChem CID 18273257) has the molecular formula C18H13BrClNO4 and a molecular weight of 422.66 g/mol. Its IUPAC name is methyl 3-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 18273257 |
| Molecular Formula | C18H13BrClNO4 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | methyl 3-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)c2oc3ccc(Br)cc3c2C)c1 |
| InChI | InChI=1S/C18H13BrClNO4/c1-9-12-8-11(19)4-6-15(12)25-16(9)17(22)21-14-7-10(18(23)24-2)3-5-13(14)20/h3-8H,1-2H3,(H,21,22) |
| InChIKey | KKMPKXACOFOBKN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |