C16H10BrF2NO2 — CID 9344702
N-(4-bromo-2-fluorophenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 9344702) has the molecular formula C16H10BrF2NO2 and a molecular weight of 366.16 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9344702 |
| Molecular Formula | C16H10BrF2NO2 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Br)cc2F)oc2ccc(F)cc12 |
| InChI | InChI=1S/C16H10BrF2NO2/c1-8-11-7-10(18)3-5-14(11)22-15(8)16(21)20-13-4-2-9(17)6-12(13)19/h2-7H,1H3,(H,20,21) |
| InChIKey | XRSDRDHLCSVURH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |