C18H15BrFNO2 — CID 118984853
5-bromo-N-[(5-fluoro-2-methylphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 118984853) has the molecular formula C18H15BrFNO2 and a molecular weight of 376.23 g/mol. Its IUPAC name is 5-bromo-N-[(5-fluoro-2-methylphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[(5-fluoro-2-methylphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 118984853 |
| Molecular Formula | C18H15BrFNO2 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 5-bromo-N-[(5-fluoro-2-methylphenyl)methyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc(F)cc1CNC(=O)c1oc2ccc(Br)cc2c1C |
| InChI | InChI=1S/C18H15BrFNO2/c1-10-3-5-14(20)7-12(10)9-21-18(22)17-11(2)15-8-13(19)4-6-16(15)23-17/h3-8H,9H2,1-2H3,(H,21,22) |
| InChIKey | FWHCKBXGUPNQMU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |