C18H14BrF2NO3 — CID 24611724
5-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 24611724) has the molecular formula C18H14BrF2NO3 and a molecular weight of 410.21 g/mol. Its IUPAC name is 5-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 24611724 |
| Molecular Formula | C18H14BrF2NO3 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 5-bromo-N-[[2-(difluoromethoxy)phenyl]methyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccccc2OC(F)F)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C18H14BrF2NO3/c1-10-13-8-12(19)6-7-15(13)24-16(10)17(23)22-9-11-4-2-3-5-14(11)25-18(20)21/h2-8,18H,9H2,1H3,(H,22,23) |
| InChIKey | OSNIFQXVECLRLU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |