C19H17BrF2N2O2 — CID 38756441
2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide (PubChem CID 38756441) has the molecular formula C19H17BrF2N2O2 and a molecular weight of 423.26 g/mol. Its IUPAC name is 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 38756441 |
| Molecular Formula | C19H17BrF2N2O2 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[[2-(difluoromethoxy)phenyl]methyl]acetamide |
| SMILES | Cc1[nH]c2ccc(Br)cc2c1CC(=O)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C19H17BrF2N2O2/c1-11-14(15-8-13(20)6-7-16(15)24-11)9-18(25)23-10-12-4-2-3-5-17(12)26-19(21)22/h2-8,19,24H,9-10H2,1H3,(H,23,25) |
| InChIKey | WDYYHHGGSHPCRP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|