C16H21BrN2O — CID 38767316
2-(5-bromo-2-methyl-1H-indol-3-yl)-N-pentylacetamide (PubChem CID 38767316) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-pentylacetamide.
| Compound Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-pentylacetamide |
|---|---|
| PubChem CID | 38767316 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)Cc1c(C)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C16H21BrN2O/c1-3-4-5-8-18-16(20)10-13-11(2)19-15-7-6-12(17)9-14(13)15/h6-7,9,19H,3-5,8,10H2,1-2H3,(H,18,20) |
| InChIKey | RUYDMLMIXQPWMV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|