C18H16BrClN2O — CID 38764960
2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 38764960) has the molecular formula C18H16BrClN2O and a molecular weight of 391.70 g/mol. Its IUPAC name is 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 38764960 |
| Molecular Formula | C18H16BrClN2O |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | Cc1[nH]c2ccc(Br)cc2c1CC(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C18H16BrClN2O/c1-11-14(15-8-13(19)6-7-17(15)22-11)9-18(23)21-10-12-4-2-3-5-16(12)20/h2-8,22H,9-10H2,1H3,(H,21,23) |
| InChIKey | TWLQSSQWAPJOGB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|