C22H26FN3O — CID 31956332
N-[3-(N-ethylanilino)propyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 31956332) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 31956332 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | CCN(CCCNC(=O)Cc1c(C)[nH]c2ccc(F)cc12)c1ccccc1 |
| InChI | InChI=1S/C22H26FN3O/c1-3-26(18-8-5-4-6-9-18)13-7-12-24-22(27)15-19-16(2)25-21-11-10-17(23)14-20(19)21/h4-6,8-11,14,25H,3,7,12-13,15H2,1-2H3,(H,24,27) |
| InChIKey | OVYHFCCSGWSAFY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|