C19H17Cl2FN2O — CID 113211872
N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 113211872) has the molecular formula C19H17Cl2FN2O and a molecular weight of 379.26 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113211872 |
| Molecular Formula | C19H17Cl2FN2O |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2FN2O/c1-11-15(16-9-14(22)4-5-18(16)24-11)10-19(25)23-7-6-12-2-3-13(20)8-17(12)21/h2-5,8-9,24H,6-7,10H2,1H3,(H,23,25) |
| InChIKey | AXMBLELTURGIKN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|