C18H15Cl2FN2O — CID 113209285
N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-1H-indol-3-yl)acetamide (PubChem CID 113209285) has the molecular formula C18H15Cl2FN2O and a molecular weight of 365.24 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113209285 |
| Molecular Formula | C18H15Cl2FN2O |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(5-fluoro-1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccc(F)cc12)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2FN2O/c19-13-2-1-11(16(20)8-13)5-6-22-18(24)7-12-10-23-17-4-3-14(21)9-15(12)17/h1-4,8-10,23H,5-7H2,(H,22,24) |
| InChIKey | SNLJAGKJLHHOQU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |