C19H16Cl2FN3O2 — CID 86964457
2,4-dichloro-N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 86964457) has the molecular formula C19H16Cl2FN3O2 and a molecular weight of 408.26 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 86964457 |
| Molecular Formula | C19H16Cl2FN3O2 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2,4-dichloro-N-[2-[2-(5-fluoro-1H-indol-3-yl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1Cl)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C19H16Cl2FN3O2/c20-12-1-3-14(16(21)7-12)19(27)25-10-18(26)23-6-5-11-9-24-17-4-2-13(22)8-15(11)17/h1-4,7-9,24H,5-6,10H2,(H,23,26)(H,25,27) |
| InChIKey | IUUQQOQDZGAJOO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |