C14H16ClN3O3 — CID 71994383
methyl N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]carbamate (PubChem CID 71994383) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is methyl N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 71994383 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | methyl N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H16ClN3O3/c1-21-14(20)18-8-13(19)16-5-4-9-7-17-12-3-2-10(15)6-11(9)12/h2-3,6-7,17H,4-5,8H2,1H3,(H,16,19)(H,18,20) |
| InChIKey | RHEQZJPMXXOVHR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |