C14H17ClN2O2 — CID 124607872
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-methoxypropanamide (PubChem CID 124607872) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-methoxypropanamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 124607872 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H17ClN2O2/c1-19-7-5-14(18)16-6-4-10-9-17-13-3-2-11(15)8-12(10)13/h2-3,8-9,17H,4-7H2,1H3,(H,16,18) |
| InChIKey | MRUNTPXHCCRUTR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |