C18H16Cl2N2O — CID 113209520
2-(5-chloro-1H-indol-3-yl)-N-[2-(3-chlorophenyl)ethyl]acetamide (PubChem CID 113209520) has the molecular formula C18H16Cl2N2O and a molecular weight of 347.25 g/mol. Its IUPAC name is 2-(5-chloro-1H-indol-3-yl)-N-[2-(3-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-(5-chloro-1H-indol-3-yl)-N-[2-(3-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 113209520 |
| Molecular Formula | C18H16Cl2N2O |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(5-chloro-1H-indol-3-yl)-N-[2-(3-chlorophenyl)ethyl]acetamide |
| SMILES | O=C(Cc1c[nH]c2ccc(Cl)cc12)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O/c19-14-3-1-2-12(8-14)6-7-21-18(23)9-13-11-22-17-5-4-15(20)10-16(13)17/h1-5,8,10-11,22H,6-7,9H2,(H,21,23) |
| InChIKey | OBTXTYLUXWKRRW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |