C24H21ClN2O — CID 67974521
4-benzyl-N-[2-(5-chloro-1H-indol-3-yl)ethyl]benzamide (PubChem CID 67974521) has the molecular formula C24H21ClN2O and a molecular weight of 388.90 g/mol. Its IUPAC name is 4-benzyl-N-[2-(5-chloro-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 4-benzyl-N-[2-(5-chloro-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 67974521 |
| Molecular Formula | C24H21ClN2O |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-benzyl-N-[2-(5-chloro-1H-indol-3-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O/c25-21-10-11-23-22(15-21)20(16-27-23)12-13-26-24(28)19-8-6-18(7-9-19)14-17-4-2-1-3-5-17/h1-11,15-16,27H,12-14H2,(H,26,28) |
| InChIKey | TXJONZLAFNGACS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |