C25H30ClN3O — CID 67974683
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-[(cyclohexylmethylamino)methyl]benzamide (PubChem CID 67974683) has the molecular formula C25H30ClN3O and a molecular weight of 423.99 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-[(cyclohexylmethylamino)methyl]benzamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-[(cyclohexylmethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 67974683 |
| Molecular Formula | C25H30ClN3O |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-[(cyclohexylmethylamino)methyl]benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1ccc(CNCC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H30ClN3O/c26-22-10-11-24-23(14-22)21(17-29-24)12-13-28-25(30)20-8-6-19(7-9-20)16-27-15-18-4-2-1-3-5-18/h6-11,14,17-18,27,29H,1-5,12-13,15-16H2,(H,28,30) |
| InChIKey | VFCVOIQTBWJNJT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |