C22H24ClN3O — CID 67974603
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-(pyrrolidin-1-ylmethyl)benzamide (PubChem CID 67974603) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-(pyrrolidin-1-ylmethyl)benzamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-(pyrrolidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 67974603 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-4-(pyrrolidin-1-ylmethyl)benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C22H24ClN3O/c23-19-7-8-21-20(13-19)18(14-25-21)9-10-24-22(27)17-5-3-16(4-6-17)15-26-11-1-2-12-26/h3-8,13-14,25H,1-2,9-12,15H2,(H,24,27) |
| InChIKey | NKSJIEJQDHYTIE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |