C17H14ClIN2O — CID 17271850
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-iodobenzamide (PubChem CID 17271850) has the molecular formula C17H14ClIN2O and a molecular weight of 424.67 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-iodobenzamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 17271850 |
| Molecular Formula | C17H14ClIN2O |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-iodobenzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1cccc(I)c1 |
| InChI | InChI=1S/C17H14ClIN2O/c18-13-4-5-16-15(9-13)12(10-21-16)6-7-20-17(22)11-2-1-3-14(19)8-11/h1-5,8-10,21H,6-7H2,(H,20,22) |
| InChIKey | KGGKUIWNWOYPNQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|