C24H20ClFN2O — CID 86699424
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-fluorophenyl)methyl]benzamide (PubChem CID 86699424) has the molecular formula C24H20ClFN2O and a molecular weight of 406.89 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 86699424 |
| Molecular Formula | C24H20ClFN2O |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[(2-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1cccc(Cc2ccccc2F)c1 |
| InChI | InChI=1S/C24H20ClFN2O/c25-20-8-9-23-21(14-20)19(15-28-23)10-11-27-24(29)18-6-3-4-16(13-18)12-17-5-1-2-7-22(17)26/h1-9,13-15,28H,10-12H2,(H,27,29) |
| InChIKey | GHKIEFGDQSUEOC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |