C24H20F2N2O — CID 67974203
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[(3-fluorophenyl)methyl]benzamide (PubChem CID 67974203) has the molecular formula C24H20F2N2O and a molecular weight of 390.43 g/mol. Its IUPAC name is N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[(3-fluorophenyl)methyl]benzamide.
| Compound Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[(3-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 67974203 |
| Molecular Formula | C24H20F2N2O |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-3-[(3-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(F)cc12)c1cccc(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C24H20F2N2O/c25-20-6-2-4-17(13-20)11-16-3-1-5-18(12-16)24(29)27-10-9-19-15-28-23-8-7-21(26)14-22(19)23/h1-8,12-15,28H,9-11H2,(H,27,29) |
| InChIKey | UNWKXYRCRWYDNG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |