C23H28FN5O — CID 111972474
N-ethyl-3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide (PubChem CID 111972474) has the molecular formula C23H28FN5O and a molecular weight of 409.51 g/mol. Its IUPAC name is N-ethyl-3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-ethyl-3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111972474 |
| Molecular Formula | C23H28FN5O |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-ethyl-3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1cccc(C/N=C(\NCC)NCCc2c[nH]c3ccc(F)cc23)c1 |
| InChI | InChI=1S/C23H28FN5O/c1-3-25-22(30)17-7-5-6-16(12-17)14-29-23(26-4-2)27-11-10-18-15-28-21-9-8-19(24)13-20(18)21/h5-9,12-13,15,28H,3-4,10-11,14H2,1-2H3,(H,25,30)(H2,26,27,29) |
| InChIKey | CRMBIOGTBLNRIU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|