C24H30FN5O — CID 111972968
3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-propylbenzamide (PubChem CID 111972968) has the molecular formula C24H30FN5O and a molecular weight of 423.54 g/mol. Its IUPAC name is 3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-propylbenzamide.
| Compound Name | 3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 111972968 |
| Molecular Formula | C24H30FN5O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 3-[[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(C/N=C(\NCC)NCCc2c[nH]c3ccc(F)cc23)c1 |
| InChI | InChI=1S/C24H30FN5O/c1-3-11-27-23(31)18-7-5-6-17(13-18)15-30-24(26-4-2)28-12-10-19-16-29-22-9-8-20(25)14-21(19)22/h5-9,13-14,16,29H,3-4,10-12,15H2,1-2H3,(H,27,31)(H2,26,28,30) |
| InChIKey | USVRRDCLZUJUMM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|