C22H27FN4O2 — CID 111972914
2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111972914) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111972914 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C22H27FN4O2/c1-4-24-22(27-14-16-6-5-7-20(28-2)21(16)29-3)25-11-10-15-13-26-19-9-8-17(23)12-18(15)19/h5-9,12-13,26H,4,10-11,14H2,1-3H3,(H2,24,25,27) |
| InChIKey | VAROZOGBNZYXPB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|