C20H25FIN5O — CID 111972921
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111972921) has the molecular formula C20H25FIN5O and a molecular weight of 497.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111972921 |
| Molecular Formula | C20H25FIN5O |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)nc1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C20H24FN5O.HI/c1-3-22-20(26-12-14-4-7-19(27-2)25-11-14)23-9-8-15-13-24-18-6-5-16(21)10-17(15)18;/h4-7,10-11,13,24H,3,8-9,12H2,1-2H3,(H2,22,23,26);1H |
| InChIKey | JJIFWBBXIMLXDV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|