C22H28FN5O2S — CID 111972422
2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111972422) has the molecular formula C22H28FN5O2S and a molecular weight of 445.56 g/mol. Its IUPAC name is 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111972422 |
| Molecular Formula | C22H28FN5O2S |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)cc1)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C22H28FN5O2S/c1-4-24-22(25-12-11-17-15-26-21-10-7-18(23)13-20(17)21)27-14-16-5-8-19(9-6-16)31(29,30)28(2)3/h5-10,13,15,26H,4,11-12,14H2,1-3H3,(H2,24,25,27) |
| InChIKey | HCYRKDXEKMKEQV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|