C16H24FN5O2S — CID 111972314
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[2-(methanesulfonamido)ethyl]guanidine (PubChem CID 111972314) has the molecular formula C16H24FN5O2S and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[2-(methanesulfonamido)ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[2-(methanesulfonamido)ethyl]guanidine |
|---|---|
| PubChem CID | 111972314 |
| Molecular Formula | C16H24FN5O2S |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[2-(methanesulfonamido)ethyl]guanidine |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C16H24FN5O2S/c1-3-18-16(20-8-9-22-25(2,23)24)19-7-6-12-11-21-15-5-4-13(17)10-14(12)15/h4-5,10-11,21-22H,3,6-9H2,1-2H3,(H2,18,19,20) |
| InChIKey | BUVBKZNWWAZNEI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|