C20H24FIN4O — CID 111989106
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111989106) has the molecular formula C20H24FIN4O and a molecular weight of 482.34 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111989106 |
| Molecular Formula | C20H24FIN4O |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(4-hydroxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(O)cc1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C20H23FN4O.HI/c1-2-22-20(25-12-14-3-6-17(26)7-4-14)23-10-9-15-13-24-19-8-5-16(21)11-18(15)19;/h3-8,11,13,24,26H,2,9-10,12H2,1H3,(H2,22,23,25);1H |
| InChIKey | XQRQOFJDHHQHQL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|