C23H25FIN5 — CID 111972617
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(isoquinolin-1-ylmethyl)guanidine;hydroiodide (PubChem CID 111972617) has the molecular formula C23H25FIN5 and a molecular weight of 517.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(isoquinolin-1-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(isoquinolin-1-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111972617 |
| Molecular Formula | C23H25FIN5 |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(isoquinolin-1-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nccc2ccccc12)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C23H24FN5.HI/c1-2-25-23(29-15-22-19-6-4-3-5-16(19)9-11-26-22)27-12-10-17-14-28-21-8-7-18(24)13-20(17)21;/h3-9,11,13-14,28H,2,10,12,15H2,1H3,(H2,25,27,29);1H |
| InChIKey | FXXXOECAGZRJJG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|