C22H28FIN4O — CID 109418477
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 109418477) has the molecular formula C22H28FIN4O and a molecular weight of 510.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109418477 |
| Molecular Formula | C22H28FIN4O |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C22H27FN4O.HI/c1-3-24-21(27-15-22(2,28)17-7-5-4-6-8-17)25-12-11-16-14-26-20-10-9-18(23)13-19(16)20;/h4-10,13-14,26,28H,3,11-12,15H2,1-2H3,(H2,24,25,27);1H |
| InChIKey | LPYYAHFCZVIPAS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|