C20H26F2IN3O — CID 109418479
1-[2-(2,4-difluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 109418479) has the molecular formula C20H26F2IN3O and a molecular weight of 489.35 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109418479 |
| Molecular Formula | C20H26F2IN3O |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCc1ccc(F)cc1F.I |
| InChI | InChI=1S/C20H25F2N3O.HI/c1-3-23-19(24-12-11-15-9-10-17(21)13-18(15)22)25-14-20(2,26)16-7-5-4-6-8-16;/h4-10,13,26H,3,11-12,14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | IDHDWTWBSKVXFW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|