C22H31FN4O — CID 109418370
1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine (PubChem CID 109418370) has the molecular formula C22H31FN4O and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109418370 |
| Molecular Formula | C22H31FN4O |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCC(c1cccc(F)c1)N(C)C |
| InChI | InChI=1S/C22H31FN4O/c1-5-24-21(26-16-22(2,28)18-11-7-6-8-12-18)25-15-20(27(3)4)17-10-9-13-19(23)14-17/h6-14,20,28H,5,15-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | YPGGXHOTENYTEY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|