C21H28N4O2 — CID 109417678
N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 109417678) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109417678 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H28N4O2/c1-3-22-20(25-16-21(2,27)18-12-8-5-9-13-18)24-15-14-23-19(26)17-10-6-4-7-11-17/h4-13,27H,3,14-16H2,1-2H3,(H,23,26)(H2,22,24,25) |
| InChIKey | ZKTPPTWRPUOTCX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|