C18H30IN3O3 — CID 109418413
methyl 5-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 109418413) has the molecular formula C18H30IN3O3 and a molecular weight of 463.36 g/mol. Its IUPAC name is methyl 5-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 109418413 |
| Molecular Formula | C18H30IN3O3 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl 5-[[N-ethyl-N'-(2-hydroxy-2-phenylpropyl)carbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCCCC(=O)OC.I |
| InChI | InChI=1S/C18H29N3O3.HI/c1-4-19-17(20-13-9-8-12-16(22)24-3)21-14-18(2,23)15-10-6-5-7-11-15;/h5-7,10-11,23H,4,8-9,12-14H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | YDYDDVZQINAYKY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|