C20H33FIN3O2 — CID 111625405
methyl 6-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]hexanoate;hydroiodide (PubChem CID 111625405) has the molecular formula C20H33FIN3O2 and a molecular weight of 493.41 g/mol. Its IUPAC name is methyl 6-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]hexanoate;hydroiodide.
| Compound Name | methyl 6-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 111625405 |
| Molecular Formula | C20H33FIN3O2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | methyl 6-[[N-ethyl-N'-[2-(3-fluorophenyl)-2-methylpropyl]carbamimidoyl]amino]hexanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(F)c1)NCCCCCC(=O)OC.I |
| InChI | InChI=1S/C20H32FN3O2.HI/c1-5-22-19(23-13-8-6-7-12-18(25)26-4)24-15-20(2,3)16-10-9-11-17(21)14-16;/h9-11,14H,5-8,12-13,15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | CDUMRMORCFFWNQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|