C18H29FIN3O3 — CID 111681855
methyl 5-[[N-ethyl-N'-[2-(3-fluorophenoxy)propyl]carbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 111681855) has the molecular formula C18H29FIN3O3 and a molecular weight of 481.35 g/mol. Its IUPAC name is methyl 5-[[N-ethyl-N'-[2-(3-fluorophenoxy)propyl]carbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N-ethyl-N'-[2-(3-fluorophenoxy)propyl]carbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111681855 |
| Molecular Formula | C18H29FIN3O3 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | methyl 5-[[N-ethyl-N'-[2-(3-fluorophenoxy)propyl]carbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Oc1cccc(F)c1)NCCCCC(=O)OC.I |
| InChI | InChI=1S/C18H28FN3O3.HI/c1-4-20-18(21-11-6-5-10-17(23)24-3)22-13-14(2)25-16-9-7-8-15(19)12-16;/h7-9,12,14H,4-6,10-11,13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | ROUSVCXKJPCNCM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|