C20H28FIN6O — CID 111655675
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111655675) has the molecular formula C20H28FIN6O and a molecular weight of 514.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111655675 |
| Molecular Formula | C20H28FIN6O |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C20H27FN6O.HI/c1-4-22-19(25-13-20(2,28)15-11-26-27(3)12-15)23-8-7-14-10-24-18-9-16(21)5-6-17(14)18;/h5-6,9-12,24,28H,4,7-8,13H2,1-3H3,(H2,22,23,25);1H |
| InChIKey | VWEPQKXRABKBQA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|