C23H24FN5O — CID 111972634
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine (PubChem CID 111972634) has the molecular formula C23H24FN5O and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111972634 |
| Molecular Formula | C23H24FN5O |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1,2-oxazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(-c2ccccc2)on1)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H24FN5O/c1-2-25-23(26-11-10-17-14-27-21-9-8-18(24)12-20(17)21)28-15-19-13-22(30-29-19)16-6-4-3-5-7-16/h3-9,12-14,27H,2,10-11,15H2,1H3,(H2,25,26,28) |
| InChIKey | GAFHCVKZJPXMNJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|