C23H24FN5 — CID 111972506
1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(quinolin-8-ylmethyl)guanidine (PubChem CID 111972506) has the molecular formula C23H24FN5 and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(quinolin-8-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(quinolin-8-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111972506 |
| Molecular Formula | C23H24FN5 |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-ethyl-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-(quinolin-8-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccc2cccnc12)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H24FN5/c1-2-25-23(29-15-18-6-3-5-16-7-4-11-26-22(16)18)27-12-10-17-14-28-21-9-8-19(24)13-20(17)21/h3-9,11,13-14,28H,2,10,12,15H2,1H3,(H2,25,27,29) |
| InChIKey | SMOHZLNNTYUGOQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|